C14H16ClN3OS — CID 64555687
2-chloro-N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 64555687) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 2-chloro-N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-chloro-N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 64555687 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-chloro-N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCNC(C)c1csc(NC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-3-16-9(2)12-8-20-14(17-12)18-13(19)10-6-4-5-7-11(10)15/h4-9,16H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | ILJPAGADCSUBEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |