C14H15F2N3OS — CID 64558466
N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]-2,5-difluorobenzamide (PubChem CID 64558466) has the molecular formula C14H15F2N3OS and a molecular weight of 311.36 g/mol. Its IUPAC name is N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]-2,5-difluorobenzamide.
| Compound Name | N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 64558466 |
| Molecular Formula | C14H15F2N3OS |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[4-[1-(ethylamino)ethyl]-1,3-thiazol-2-yl]-2,5-difluorobenzamide |
| SMILES | CCNC(C)c1csc(NC(=O)c2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C14H15F2N3OS/c1-3-17-8(2)12-7-21-14(18-12)19-13(20)10-6-9(15)4-5-11(10)16/h4-8,17H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | PBEGZGQEIRLXDP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |