C15H18FN3OS — CID 64557871
4-fluoro-N-[4-[1-(propylamino)ethyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 64557871) has the molecular formula C15H18FN3OS and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-fluoro-N-[4-[1-(propylamino)ethyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[4-[1-(propylamino)ethyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 64557871 |
| Molecular Formula | C15H18FN3OS |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-fluoro-N-[4-[1-(propylamino)ethyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCNC(C)c1csc(NC(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H18FN3OS/c1-3-8-17-10(2)13-9-21-15(18-13)19-14(20)11-4-6-12(16)7-5-11/h4-7,9-10,17H,3,8H2,1-2H3,(H,18,19,20) |
| InChIKey | RUOBRRAWRCALNK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |