C14H20ClNO3 — CID 64556752
2-(3-chlorophenoxy)-N-(1-hydroxy-2-methylbutan-2-yl)propanamide (PubChem CID 64556752) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(1-hydroxy-2-methylbutan-2-yl)propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(1-hydroxy-2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 64556752 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(1-hydroxy-2-methylbutan-2-yl)propanamide |
| SMILES | CCC(C)(CO)NC(=O)C(C)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO3/c1-4-14(3,9-17)16-13(18)10(2)19-12-7-5-6-11(15)8-12/h5-8,10,17H,4,9H2,1-3H3,(H,16,18) |
| InChIKey | RVKMBOVZQHGMGL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |