C14H25NO4S — CID 64560143
1-(cyclohexylmethylsulfonyl)azepane-2-carboxylic acid (PubChem CID 64560143) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is 1-(cyclohexylmethylsulfonyl)azepane-2-carboxylic acid.
| Compound Name | 1-(cyclohexylmethylsulfonyl)azepane-2-carboxylic acid |
|---|---|
| PubChem CID | 64560143 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-(cyclohexylmethylsulfonyl)azepane-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCCN1S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C14H25NO4S/c16-14(17)13-9-5-2-6-10-15(13)20(18,19)11-12-7-3-1-4-8-12/h12-13H,1-11H2,(H,16,17) |
| InChIKey | NJJDEIOKVBEHGI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |