C17H19F2NO — CID 64561584
2-(2,4-difluorophenyl)-1-(4-propoxyphenyl)ethanamine (PubChem CID 64561584) has the molecular formula C17H19F2NO and a molecular weight of 291.34 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(4-propoxyphenyl)ethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-1-(4-propoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 64561584 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(4-propoxyphenyl)ethanamine |
| SMILES | CCCOc1ccc(C(N)Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H19F2NO/c1-2-9-21-15-7-4-12(5-8-15)17(20)10-13-3-6-14(18)11-16(13)19/h3-8,11,17H,2,9-10,20H2,1H3 |
| InChIKey | YPEGBYNRWZZGGA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |