C17H19F2N — CID 64559469
2-(2,4-difluorophenyl)-1-(4-propylphenyl)ethanamine (PubChem CID 64559469) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(4-propylphenyl)ethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-1-(4-propylphenyl)ethanamine |
|---|---|
| PubChem CID | 64559469 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(4-propylphenyl)ethanamine |
| SMILES | CCCc1ccc(C(N)Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H19F2N/c1-2-3-12-4-6-13(7-5-12)17(20)10-14-8-9-15(18)11-16(14)19/h4-9,11,17H,2-3,10,20H2,1H3 |
| InChIKey | APTXUKNETJMNKI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |