C15H21F3N2O — CID 64566158
1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]piperidin-3-amine (PubChem CID 64566158) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]piperidin-3-amine.
| Compound Name | 1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 64566158 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]piperidin-3-amine |
| SMILES | Cc1ccc(OCCC(F)(F)F)c(N2CCCC(N)C2)c1 |
| InChI | InChI=1S/C15H21F3N2O/c1-11-4-5-14(21-8-6-15(16,17)18)13(9-11)20-7-2-3-12(19)10-20/h4-5,9,12H,2-3,6-8,10,19H2,1H3 |
| InChIKey | LGDNOVZSWFEXFW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |