C10H7F3N4O2S — CID 64572837
2-[[5-amino-4-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 64572837) has the molecular formula C10H7F3N4O2S and a molecular weight of 304.25 g/mol. Its IUPAC name is 2-[[5-amino-4-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-amino-4-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 64572837 |
| Molecular Formula | C10H7F3N4O2S |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 2-[[5-amino-4-(3,4,5-trifluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Nc1nnc(SCC(=O)O)n1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H7F3N4O2S/c11-5-1-4(2-6(12)8(5)13)17-9(14)15-16-10(17)20-3-7(18)19/h1-2H,3H2,(H2,14,15)(H,18,19) |
| InChIKey | DTRFCCXJMCGRSJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|