C10H9IN4O2S — CID 64573034
2-[[5-amino-4-(3-iodophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 64573034) has the molecular formula C10H9IN4O2S and a molecular weight of 376.18 g/mol. Its IUPAC name is 2-[[5-amino-4-(3-iodophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-amino-4-(3-iodophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 64573034 |
| Molecular Formula | C10H9IN4O2S |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 2-[[5-amino-4-(3-iodophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Nc1nnc(SCC(=O)O)n1-c1cccc(I)c1 |
| InChI | InChI=1S/C10H9IN4O2S/c11-6-2-1-3-7(4-6)15-9(12)13-14-10(15)18-5-8(16)17/h1-4H,5H2,(H2,12,13)(H,16,17) |
| InChIKey | WJLLGMNZHSDTIO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|