C12H22N2O5 — CID 64575850
3-[(4-ethoxy-4-oxobutyl)carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 64575850) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-[(4-ethoxy-4-oxobutyl)carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(4-ethoxy-4-oxobutyl)carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64575850 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-[(4-ethoxy-4-oxobutyl)carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CCOC(=O)CCCNC(=O)N(C)CC(C)C(=O)O |
| InChI | InChI=1S/C12H22N2O5/c1-4-19-10(15)6-5-7-13-12(18)14(3)8-9(2)11(16)17/h9H,4-8H2,1-3H3,(H,13,18)(H,16,17) |
| InChIKey | UJLJHZNVOMZPOX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|