C8H17N3O5S — CID 55007854
2-methyl-3-[methyl(2-sulfamoylethylcarbamoyl)amino]propanoic acid (PubChem CID 55007854) has the molecular formula C8H17N3O5S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-methyl-3-[methyl(2-sulfamoylethylcarbamoyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl(2-sulfamoylethylcarbamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 55007854 |
| Molecular Formula | C8H17N3O5S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-methyl-3-[methyl(2-sulfamoylethylcarbamoyl)amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)NCCS(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C8H17N3O5S/c1-6(7(12)13)5-11(2)8(14)10-3-4-17(9,15)16/h6H,3-5H2,1-2H3,(H,10,14)(H,12,13)(H2,9,15,16) |
| InChIKey | WLJDIJFMCHVAHO-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |