C9H12N4O2 — CID 64577078
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)prop-2-enoic acid (PubChem CID 64577078) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)prop-2-enoic acid.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 64577078 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)prop-2-enoic acid |
| SMILES | C=C(CN1CCn2cnnc2C1)C(=O)O |
| InChI | InChI=1S/C9H12N4O2/c1-7(9(14)15)4-12-2-3-13-6-10-11-8(13)5-12/h6H,1-5H2,(H,14,15) |
| InChIKey | LKFRTHUYWNSPGF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|