C13H23N5 — CID 64579846
N-[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pentyl]cyclopropanamine (PubChem CID 64579846) has the molecular formula C13H23N5 and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pentyl]cyclopropanamine.
| Compound Name | N-[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pentyl]cyclopropanamine |
|---|---|
| PubChem CID | 64579846 |
| Molecular Formula | C13H23N5 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N-[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pentyl]cyclopropanamine |
| SMILES | CC(CCCNC1CC1)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C13H23N5/c1-11(3-2-6-14-12-4-5-12)17-7-8-18-10-15-16-13(18)9-17/h10-12,14H,2-9H2,1H3 |
| InChIKey | OCODBNQMMZLOQT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|