C16H20ClF2NO — CID 64594247
3-chloro-N-(3-cyclopropylcyclohexyl)-4-(difluoromethoxy)aniline (PubChem CID 64594247) has the molecular formula C16H20ClF2NO and a molecular weight of 315.79 g/mol. Its IUPAC name is 3-chloro-N-(3-cyclopropylcyclohexyl)-4-(difluoromethoxy)aniline.
| Compound Name | 3-chloro-N-(3-cyclopropylcyclohexyl)-4-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 64594247 |
| Molecular Formula | C16H20ClF2NO |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3-chloro-N-(3-cyclopropylcyclohexyl)-4-(difluoromethoxy)aniline |
| SMILES | FC(F)Oc1ccc(NC2CCCC(C3CC3)C2)cc1Cl |
| InChI | InChI=1S/C16H20ClF2NO/c17-14-9-13(6-7-15(14)21-16(18)19)20-12-3-1-2-11(8-12)10-4-5-10/h6-7,9-12,16,20H,1-5,8H2 |
| InChIKey | ONONQEUFSSNMTL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|