C14H21N5 — CID 64599453
2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-6-methylaniline (PubChem CID 64599453) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-6-methylaniline.
| Compound Name | 2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-6-methylaniline |
|---|---|
| PubChem CID | 64599453 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-6-methylaniline |
| SMILES | Cc1cccc(-c2nnnn2CC(C)C(C)C)c1N |
| InChI | InChI=1S/C14H21N5/c1-9(2)11(4)8-19-14(16-17-18-19)12-7-5-6-10(3)13(12)15/h5-7,9,11H,8,15H2,1-4H3 |
| InChIKey | DXHBPRVJJRTAAZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|