C15H23N5O — CID 81397181
2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-3-ethoxyaniline (PubChem CID 81397181) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-3-ethoxyaniline.
| Compound Name | 2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-3-ethoxyaniline |
|---|---|
| PubChem CID | 81397181 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 2-[1-(2,3-dimethylbutyl)tetrazol-5-yl]-3-ethoxyaniline |
| SMILES | CCOc1cccc(N)c1-c1nnnn1CC(C)C(C)C |
| InChI | InChI=1S/C15H23N5O/c1-5-21-13-8-6-7-12(16)14(13)15-17-18-19-20(15)9-11(4)10(2)3/h6-8,10-11H,5,9,16H2,1-4H3 |
| InChIKey | AZPXQMHYQXQIOE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|