C11H14ClN5O — CID 64599895
1-[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]-N-methylmethanamine (PubChem CID 64599895) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is 1-[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 64599895 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1cn(CCOc2cncc(Cl)c2)nn1 |
| InChI | InChI=1S/C11H14ClN5O/c1-13-6-10-8-17(16-15-10)2-3-18-11-4-9(12)5-14-7-11/h4-5,7-8,13H,2-3,6H2,1H3 |
| InChIKey | CSNGWQXWLQBOGU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |