C14H20ClN5O — CID 64602362
N-[[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 64602362) has the molecular formula C14H20ClN5O and a molecular weight of 309.80 g/mol. Its IUPAC name is N-[[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 64602362 |
| Molecular Formula | C14H20ClN5O |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[[1-[2-[(5-chloro-3-pyridinyl)oxy]ethyl]triazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cn(CCOc2cncc(Cl)c2)nn1 |
| InChI | InChI=1S/C14H20ClN5O/c1-11(2)6-16-8-13-10-20(19-18-13)3-4-21-14-5-12(15)7-17-9-14/h5,7,9-11,16H,3-4,6,8H2,1-2H3 |
| InChIKey | UGDXANXGOASAFO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |