C17H17F2N3O3S — CID 6460114
N-[4-[(2,6-difluorophenyl)sulfamoyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 6460114) has the molecular formula C17H17F2N3O3S and a molecular weight of 381.40 g/mol. Its IUPAC name is N-[4-[(2,6-difluorophenyl)sulfamoyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[4-[(2,6-difluorophenyl)sulfamoyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 6460114 |
| Molecular Formula | C17H17F2N3O3S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[4-[(2,6-difluorophenyl)sulfamoyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2c(F)cccc2F)cc1)N1CCCC1 |
| InChI | InChI=1S/C17H17F2N3O3S/c18-14-4-3-5-15(19)16(14)21-26(24,25)13-8-6-12(7-9-13)20-17(23)22-10-1-2-11-22/h3-9,21H,1-2,10-11H2,(H,20,23) |
| InChIKey | ODHFAXVDIHZQNX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |