C11H15ClN2O4S — CID 64607306
3-chloro-5-(3-ethylmorpholin-4-yl)sulfonyl-1H-pyridin-2-one (PubChem CID 64607306) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is 3-chloro-5-(3-ethylmorpholin-4-yl)sulfonyl-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-(3-ethylmorpholin-4-yl)sulfonyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 64607306 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 3-chloro-5-(3-ethylmorpholin-4-yl)sulfonyl-1H-pyridin-2-one |
| SMILES | CCC1COCCN1S(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O4S/c1-2-8-7-18-4-3-14(8)19(16,17)9-5-10(12)11(15)13-6-9/h5-6,8H,2-4,7H2,1H3,(H,13,15) |
| InChIKey | PNTNIZUEUKCKHE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |