C13H20ClN3O3S — CID 64607317
5-chloro-6-oxo-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-pyridine-3-sulfonamide (PubChem CID 64607317) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 5-chloro-6-oxo-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-oxo-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607317 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 5-chloro-6-oxo-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]-1H-pyridine-3-sulfonamide |
| SMILES | CC(C)N1CCC(CNS(=O)(=O)c2c[nH]c(=O)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H20ClN3O3S/c1-9(2)17-4-3-10(8-17)6-16-21(19,20)11-5-12(14)13(18)15-7-11/h5,7,9-10,16H,3-4,6,8H2,1-2H3,(H,15,18) |
| InChIKey | ZYWYKGRRYLBGFF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |