C18H32ClNO2 — CID 6460908
1-(3,5-dimethyl-1-adamantyl)-2-morpholin-4-ylethanol;hydrochloride (PubChem CID 6460908) has the molecular formula C18H32ClNO2 and a molecular weight of 329.91 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-2-morpholin-4-ylethanol;hydrochloride.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-2-morpholin-4-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 6460908 |
| Molecular Formula | C18H32ClNO2 |
| Molecular Weight | 329.91 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-2-morpholin-4-ylethanol;hydrochloride |
| SMILES | CC12CC3CC(C)(C1)CC(C(O)CN1CCOCC1)(C3)C2.Cl |
| InChI | InChI=1S/C18H31NO2.ClH/c1-16-7-14-8-17(2,11-16)13-18(9-14,12-16)15(20)10-19-3-5-21-6-4-19;/h14-15,20H,3-13H2,1-2H3;1H |
| InChIKey | FZELUNSXNWOAJC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |