C15H27NOS — CID 64609276
3-(furan-2-ylmethylsulfanyl)-N-propylheptan-4-amine (PubChem CID 64609276) has the molecular formula C15H27NOS and a molecular weight of 269.45 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfanyl)-N-propylheptan-4-amine.
| Compound Name | 3-(furan-2-ylmethylsulfanyl)-N-propylheptan-4-amine |
|---|---|
| PubChem CID | 64609276 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 3-(furan-2-ylmethylsulfanyl)-N-propylheptan-4-amine |
| SMILES | CCCNC(CCC)C(CC)SCc1ccco1 |
| InChI | InChI=1S/C15H27NOS/c1-4-8-14(16-10-5-2)15(6-3)18-12-13-9-7-11-17-13/h7,9,11,14-16H,4-6,8,10,12H2,1-3H3 |
| InChIKey | VETABSKUEJDPHN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |