C15H21F2NS — CID 64613286
2-(2,4-difluorophenyl)sulfanyl-N-methylcyclooctan-1-amine (PubChem CID 64613286) has the molecular formula C15H21F2NS and a molecular weight of 285.40 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfanyl-N-methylcyclooctan-1-amine.
| Compound Name | 2-(2,4-difluorophenyl)sulfanyl-N-methylcyclooctan-1-amine |
|---|---|
| PubChem CID | 64613286 |
| Molecular Formula | C15H21F2NS |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfanyl-N-methylcyclooctan-1-amine |
| SMILES | CNC1CCCCCCC1Sc1ccc(F)cc1F |
| InChI | InChI=1S/C15H21F2NS/c1-18-13-6-4-2-3-5-7-15(13)19-14-9-8-11(16)10-12(14)17/h8-10,13,15,18H,2-7H2,1H3 |
| InChIKey | CKLQEPRXPMNMBE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |