C14H20FNS — CID 64621640
2-(2-fluorophenyl)sulfanyl-N-methylcycloheptan-1-amine (PubChem CID 64621640) has the molecular formula C14H20FNS and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-methylcycloheptan-1-amine.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-methylcycloheptan-1-amine |
|---|---|
| PubChem CID | 64621640 |
| Molecular Formula | C14H20FNS |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-methylcycloheptan-1-amine |
| SMILES | CNC1CCCCCC1Sc1ccccc1F |
| InChI | InChI=1S/C14H20FNS/c1-16-12-8-3-2-4-10-14(12)17-13-9-6-5-7-11(13)15/h5-7,9,12,14,16H,2-4,8,10H2,1H3 |
| InChIKey | TYNJAXNXRNNYHE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |