C11H17NOS2 — CID 64613800
N-ethyl-3-thiophen-2-ylsulfanyloxan-4-amine (PubChem CID 64613800) has the molecular formula C11H17NOS2 and a molecular weight of 243.40 g/mol. Its IUPAC name is N-ethyl-3-thiophen-2-ylsulfanyloxan-4-amine.
| Compound Name | N-ethyl-3-thiophen-2-ylsulfanyloxan-4-amine |
|---|---|
| PubChem CID | 64613800 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-ethyl-3-thiophen-2-ylsulfanyloxan-4-amine |
| SMILES | CCNC1CCOCC1Sc1cccs1 |
| InChI | InChI=1S/C11H17NOS2/c1-2-12-9-5-6-13-8-10(9)15-11-4-3-7-14-11/h3-4,7,9-10,12H,2,5-6,8H2,1H3 |
| InChIKey | MFDIJFAYDSBEAZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |