C11H19NOS2 — CID 62579220
N-(3-methoxypropyl)-2-thiophen-2-ylsulfanylpropan-1-amine (PubChem CID 62579220) has the molecular formula C11H19NOS2 and a molecular weight of 245.41 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-thiophen-2-ylsulfanylpropan-1-amine.
| Compound Name | N-(3-methoxypropyl)-2-thiophen-2-ylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 62579220 |
| Molecular Formula | C11H19NOS2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(3-methoxypropyl)-2-thiophen-2-ylsulfanylpropan-1-amine |
| SMILES | COCCCNCC(C)Sc1cccs1 |
| InChI | InChI=1S/C11H19NOS2/c1-10(9-12-6-4-7-13-2)15-11-5-3-8-14-11/h3,5,8,10,12H,4,6-7,9H2,1-2H3 |
| InChIKey | CQULKHOIJKQBKI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|