C14H20BrNS — CID 64613900
2-(4-bromophenyl)sulfanyl-4-ethylcyclohexan-1-amine (PubChem CID 64613900) has the molecular formula C14H20BrNS and a molecular weight of 314.29 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-4-ethylcyclohexan-1-amine.
| Compound Name | 2-(4-bromophenyl)sulfanyl-4-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64613900 |
| Molecular Formula | C14H20BrNS |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-4-ethylcyclohexan-1-amine |
| SMILES | CCC1CCC(N)C(Sc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C14H20BrNS/c1-2-10-3-8-13(16)14(9-10)17-12-6-4-11(15)5-7-12/h4-7,10,13-14H,2-3,8-9,16H2,1H3 |
| InChIKey | YTVAARKMDCMEQS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |