C16H22O3S — CID 63099271
4-ethyl-2-(4-methoxyphenyl)sulfanylcyclohexane-1-carboxylic acid (PubChem CID 63099271) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-ethyl-2-(4-methoxyphenyl)sulfanylcyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-2-(4-methoxyphenyl)sulfanylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63099271 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-ethyl-2-(4-methoxyphenyl)sulfanylcyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(C(=O)O)C(Sc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C16H22O3S/c1-3-11-4-9-14(16(17)18)15(10-11)20-13-7-5-12(19-2)6-8-13/h5-8,11,14-15H,3-4,9-10H2,1-2H3,(H,17,18) |
| InChIKey | WZKKIHAMRCCELU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |