C14H20O3S — CID 63098068
4-ethyl-2-(furan-2-ylmethylsulfanyl)cyclohexane-1-carboxylic acid (PubChem CID 63098068) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 4-ethyl-2-(furan-2-ylmethylsulfanyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-2-(furan-2-ylmethylsulfanyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63098068 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-ethyl-2-(furan-2-ylmethylsulfanyl)cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(C(=O)O)C(SCc2ccco2)C1 |
| InChI | InChI=1S/C14H20O3S/c1-2-10-5-6-12(14(15)16)13(8-10)18-9-11-4-3-7-17-11/h3-4,7,10,12-13H,2,5-6,8-9H2,1H3,(H,15,16) |
| InChIKey | XYOCLHHGMZKWQD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |