C15H25NOS — CID 64609685
N,4-diethyl-2-(furan-2-ylmethylsulfanyl)cyclohexan-1-amine (PubChem CID 64609685) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is N,4-diethyl-2-(furan-2-ylmethylsulfanyl)cyclohexan-1-amine.
| Compound Name | N,4-diethyl-2-(furan-2-ylmethylsulfanyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64609685 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N,4-diethyl-2-(furan-2-ylmethylsulfanyl)cyclohexan-1-amine |
| SMILES | CCNC1CCC(CC)CC1SCc1ccco1 |
| InChI | InChI=1S/C15H25NOS/c1-3-12-7-8-14(16-4-2)15(10-12)18-11-13-6-5-9-17-13/h5-6,9,12,14-16H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | KODQYXLGGOGHEX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |