C17H25N3S — CID 64621304
2-(1H-benzimidazol-2-ylsulfanyl)-N,4-diethylcyclohexan-1-amine (PubChem CID 64621304) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N,4-diethylcyclohexan-1-amine.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N,4-diethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64621304 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N,4-diethylcyclohexan-1-amine |
| SMILES | CCNC1CCC(CC)CC1Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H25N3S/c1-3-12-9-10-15(18-4-2)16(11-12)21-17-19-13-7-5-6-8-14(13)20-17/h5-8,12,15-16,18H,3-4,9-11H2,1-2H3,(H,19,20) |
| InChIKey | VRYKHVVHSVVOCZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |