C17H22N2S — CID 102451382
2-[[(1R,3S,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-1H-benzimidazole (PubChem CID 102451382) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 2-[[(1R,3S,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-1H-benzimidazole.
| Compound Name | 2-[[(1R,3S,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 102451382 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-[[(1R,3S,4R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl]sulfanyl]-1H-benzimidazole |
| SMILES | C[C@@H]1C[C@H]2[C@@H](C[C@@H]1Sc1nc3ccccc3[nH]1)C2(C)C |
| InChI | InChI=1S/C17H22N2S/c1-10-8-11-12(17(11,2)3)9-15(10)20-16-18-13-6-4-5-7-14(13)19-16/h4-7,10-12,15H,8-9H2,1-3H3,(H,18,19)/t10-,11+,12-,15+/m1/s1 |
| InChIKey | DYLDFAPHAZWYFH-ZAZJYDDPSA-N |
| XLogP | 4.73 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |