C12H21N3S — CID 107783843
4-ethyl-2-(1H-imidazol-2-ylsulfanyl)-N-methylcyclohexan-1-amine (PubChem CID 107783843) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 4-ethyl-2-(1H-imidazol-2-ylsulfanyl)-N-methylcyclohexan-1-amine.
| Compound Name | 4-ethyl-2-(1H-imidazol-2-ylsulfanyl)-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 107783843 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-ethyl-2-(1H-imidazol-2-ylsulfanyl)-N-methylcyclohexan-1-amine |
| SMILES | CCC1CCC(NC)C(Sc2ncc[nH]2)C1 |
| InChI | InChI=1S/C12H21N3S/c1-3-9-4-5-10(13-2)11(8-9)16-12-14-6-7-15-12/h6-7,9-11,13H,3-5,8H2,1-2H3,(H,14,15) |
| InChIKey | HOGBAZNZZUQTSO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |