C13H12F3N3O2 — CID 64622706
4-[ethyl(2,2,2-trifluoroethyl)amino]cinnoline-3-carboxylic acid (PubChem CID 64622706) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]cinnoline-3-carboxylic acid.
| Compound Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]cinnoline-3-carboxylic acid |
|---|---|
| PubChem CID | 64622706 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]cinnoline-3-carboxylic acid |
| SMILES | CCN(CC(F)(F)F)c1c(C(=O)O)nnc2ccccc12 |
| InChI | InChI=1S/C13H12F3N3O2/c1-2-19(7-13(14,15)16)11-8-5-3-4-6-9(8)17-18-10(11)12(20)21/h3-6H,2,7H2,1H3,(H,20,21) |
| InChIKey | IGUWSMXYXUDRSQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |