C14H21NOS — CID 64628119
2-(2-methoxyphenyl)sulfanylcycloheptan-1-amine (PubChem CID 64628119) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)sulfanylcycloheptan-1-amine.
| Compound Name | 2-(2-methoxyphenyl)sulfanylcycloheptan-1-amine |
|---|---|
| PubChem CID | 64628119 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(2-methoxyphenyl)sulfanylcycloheptan-1-amine |
| SMILES | COc1ccccc1SC1CCCCCC1N |
| InChI | InChI=1S/C14H21NOS/c1-16-12-8-5-6-10-14(12)17-13-9-4-2-3-7-11(13)15/h5-6,8,10-11,13H,2-4,7,9,15H2,1H3 |
| InChIKey | AKTOYWUSFILSRQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |