C8H14N4OS — CID 64628137
3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxan-4-amine (PubChem CID 64628137) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxan-4-amine.
| Compound Name | 3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxan-4-amine |
|---|---|
| PubChem CID | 64628137 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]oxan-4-amine |
| SMILES | Cc1nc(SC2COCCC2N)n[nH]1 |
| InChI | InChI=1S/C8H14N4OS/c1-5-10-8(12-11-5)14-7-4-13-3-2-6(7)9/h6-7H,2-4,9H2,1H3,(H,10,11,12) |
| InChIKey | PXXZPWYVUUNWLX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |