C13H19ClN2S — CID 64631481
2-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylcyclohexan-1-amine (PubChem CID 64631481) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylcyclohexan-1-amine.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64631481 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylcyclohexan-1-amine |
| SMILES | CCNC1CCCCC1Sc1ncccc1Cl |
| InChI | InChI=1S/C13H19ClN2S/c1-2-15-11-7-3-4-8-12(11)17-13-10(14)6-5-9-16-13/h5-6,9,11-12,15H,2-4,7-8H2,1H3 |
| InChIKey | XNMMKRYITZQSIO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |