C12H22N4S — CID 64620816
N-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclooctan-1-amine (PubChem CID 64620816) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is N-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclooctan-1-amine.
| Compound Name | N-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclooctan-1-amine |
|---|---|
| PubChem CID | 64620816 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-ethyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)cyclooctan-1-amine |
| SMILES | CCNC1CCCCCCC1Sc1ncn[nH]1 |
| InChI | InChI=1S/C12H22N4S/c1-2-13-10-7-5-3-4-6-8-11(10)17-12-14-9-15-16-12/h9-11,13H,2-8H2,1H3,(H,14,15,16) |
| InChIKey | RRHIOBXFCXUPNH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |