C6H16N2O4S2 — CID 64631627
2-amino-N-(1-methylsulfonylpropan-2-yl)ethanesulfonamide (PubChem CID 64631627) has the molecular formula C6H16N2O4S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-amino-N-(1-methylsulfonylpropan-2-yl)ethanesulfonamide.
| Compound Name | 2-amino-N-(1-methylsulfonylpropan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 64631627 |
| Molecular Formula | C6H16N2O4S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-amino-N-(1-methylsulfonylpropan-2-yl)ethanesulfonamide |
| SMILES | CC(CS(C)(=O)=O)NS(=O)(=O)CCN |
| InChI | InChI=1S/C6H16N2O4S2/c1-6(5-13(2,9)10)8-14(11,12)4-3-7/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | VTKQHBGXDRIZRK-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |