C11H18N2O4S2 — CID 64631806
4-(aminomethyl)-N-(1-methylsulfonylpropan-2-yl)benzenesulfonamide (PubChem CID 64631806) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(1-methylsulfonylpropan-2-yl)benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-N-(1-methylsulfonylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 64631806 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-(aminomethyl)-N-(1-methylsulfonylpropan-2-yl)benzenesulfonamide |
| SMILES | CC(CS(C)(=O)=O)NS(=O)(=O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-9(8-18(2,14)15)13-19(16,17)11-5-3-10(7-12)4-6-11/h3-6,9,13H,7-8,12H2,1-2H3 |
| InChIKey | DRMRFGWBWYYTQA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |