C12H17NO6S2 — CID 64630006
2-methyl-5-(1-methylsulfonylpropan-2-ylsulfamoyl)benzoic acid (PubChem CID 64630006) has the molecular formula C12H17NO6S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-methyl-5-(1-methylsulfonylpropan-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-methyl-5-(1-methylsulfonylpropan-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 64630006 |
| Molecular Formula | C12H17NO6S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-methyl-5-(1-methylsulfonylpropan-2-ylsulfamoyl)benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)CS(C)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C12H17NO6S2/c1-8-4-5-10(6-11(8)12(14)15)21(18,19)13-9(2)7-20(3,16)17/h4-6,9,13H,7H2,1-3H3,(H,14,15) |
| InChIKey | HRUQGVCYJWCNMA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |