C12H18N2O4S3 — CID 106920261
2-methyl-4-(1-methylsulfonylpropan-2-ylsulfamoyl)benzenecarbothioamide (PubChem CID 106920261) has the molecular formula C12H18N2O4S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-methyl-4-(1-methylsulfonylpropan-2-ylsulfamoyl)benzenecarbothioamide.
| Compound Name | 2-methyl-4-(1-methylsulfonylpropan-2-ylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 106920261 |
| Molecular Formula | C12H18N2O4S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-methyl-4-(1-methylsulfonylpropan-2-ylsulfamoyl)benzenecarbothioamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)CS(C)(=O)=O)ccc1C(N)=S |
| InChI | InChI=1S/C12H18N2O4S3/c1-8-6-10(4-5-11(8)12(13)19)21(17,18)14-9(2)7-20(3,15)16/h4-6,9,14H,7H2,1-3H3,(H2,13,19) |
| InChIKey | MHWCQHCQGHUCRV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|