C15H19BrO2S — CID 64635308
1-(3-bromophenyl)-2-(3-methylcyclohexyl)sulfinylethanone (PubChem CID 64635308) has the molecular formula C15H19BrO2S and a molecular weight of 343.29 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(3-methylcyclohexyl)sulfinylethanone.
| Compound Name | 1-(3-bromophenyl)-2-(3-methylcyclohexyl)sulfinylethanone |
|---|---|
| PubChem CID | 64635308 |
| Molecular Formula | C15H19BrO2S |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-(3-bromophenyl)-2-(3-methylcyclohexyl)sulfinylethanone |
| SMILES | CC1CCCC(S(=O)CC(=O)c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C15H19BrO2S/c1-11-4-2-7-14(8-11)19(18)10-15(17)12-5-3-6-13(16)9-12/h3,5-6,9,11,14H,2,4,7-8,10H2,1H3 |
| InChIKey | IQMHNELBWZNNMW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |