C16H21BrO3S — CID 64637769
1-(3-bromo-4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanone (PubChem CID 64637769) has the molecular formula C16H21BrO3S and a molecular weight of 373.31 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanone.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanone |
|---|---|
| PubChem CID | 64637769 |
| Molecular Formula | C16H21BrO3S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanone |
| SMILES | COc1ccc(C(=O)CS(=O)C2CCCC(C)C2)cc1Br |
| InChI | InChI=1S/C16H21BrO3S/c1-11-4-3-5-13(8-11)21(19)10-15(18)12-6-7-16(20-2)14(17)9-12/h6-7,9,11,13H,3-5,8,10H2,1-2H3 |
| InChIKey | MXTICGSBLFVNRI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |