C16H21ClO2S — CID 64635686
1-(3-chlorophenyl)-2-(3-methylcyclohexyl)sulfinylpropan-1-one (PubChem CID 64635686) has the molecular formula C16H21ClO2S and a molecular weight of 312.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(3-methylcyclohexyl)sulfinylpropan-1-one.
| Compound Name | 1-(3-chlorophenyl)-2-(3-methylcyclohexyl)sulfinylpropan-1-one |
|---|---|
| PubChem CID | 64635686 |
| Molecular Formula | C16H21ClO2S |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(3-methylcyclohexyl)sulfinylpropan-1-one |
| SMILES | CC1CCCC(S(=O)C(C)C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H21ClO2S/c1-11-5-3-8-15(9-11)20(19)12(2)16(18)13-6-4-7-14(17)10-13/h4,6-7,10-12,15H,3,5,8-9H2,1-2H3 |
| InChIKey | ZIPQNSYUXIIENY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |