C15H11ClF2O2S — CID 64637415
2-(4-chlorophenyl)sulfinyl-1-(3,4-difluorophenyl)propan-1-one (PubChem CID 64637415) has the molecular formula C15H11ClF2O2S and a molecular weight of 328.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfinyl-1-(3,4-difluorophenyl)propan-1-one.
| Compound Name | 2-(4-chlorophenyl)sulfinyl-1-(3,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 64637415 |
| Molecular Formula | C15H11ClF2O2S |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-(4-chlorophenyl)sulfinyl-1-(3,4-difluorophenyl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(F)c(F)c1)S(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClF2O2S/c1-9(21(20)12-5-3-11(16)4-6-12)15(19)10-2-7-13(17)14(18)8-10/h2-9H,1H3 |
| InChIKey | OKTRBLVBDBAGTQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |