C13H16F2O2S — CID 64640863
2-butan-2-ylsulfinyl-1-(3,4-difluorophenyl)propan-1-one (PubChem CID 64640863) has the molecular formula C13H16F2O2S and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-butan-2-ylsulfinyl-1-(3,4-difluorophenyl)propan-1-one.
| Compound Name | 2-butan-2-ylsulfinyl-1-(3,4-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 64640863 |
| Molecular Formula | C13H16F2O2S |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-butan-2-ylsulfinyl-1-(3,4-difluorophenyl)propan-1-one |
| SMILES | CCC(C)S(=O)C(C)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H16F2O2S/c1-4-8(2)18(17)9(3)13(16)10-5-6-11(14)12(15)7-10/h5-9H,4H2,1-3H3 |
| InChIKey | SUCZEFYTOWEWRP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |