C14H13NO4S2 — CID 64639325
1-(2,5-dimethylthiophen-3-yl)-2-(4-nitrophenyl)sulfinylethanone (PubChem CID 64639325) has the molecular formula C14H13NO4S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-2-(4-nitrophenyl)sulfinylethanone.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-2-(4-nitrophenyl)sulfinylethanone |
|---|---|
| PubChem CID | 64639325 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-2-(4-nitrophenyl)sulfinylethanone |
| SMILES | Cc1cc(C(=O)CS(=O)c2ccc([N+](=O)[O-])cc2)c(C)s1 |
| InChI | InChI=1S/C14H13NO4S2/c1-9-7-13(10(2)20-9)14(16)8-21(19)12-5-3-11(4-6-12)15(17)18/h3-7H,8H2,1-2H3 |
| InChIKey | IOXYRNHOWYDIKX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|